Products 349410-58-8
CAS 349410-58-8 appears in our catalog under these names: 2-(4-Nitrophenyl)-1-(4-phenylpiperazin-1-yl)ethanone, 95%, 2–(4–Nitrophenyl)–1–(4–phenylpiperazin–1–yl)ethanone, 2-(4-nitrophenyl)-1-(4-phenylpiperazin-1-yl)ethanone. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
2-(4-nitrophenyl)-1-(4-phenylpiperazin-1-yl)ethanone (CAS 349410-58-8) is a chemical compound with the molecular formula C18H19N3O3 and a molecular weight of 325.4 g/mol. IUPAC name: 2-(4-nitrophenyl)-1-(4-phenylpiperazin-1-yl)ethanone. InChIKey: CTDWOWIAEZCJQN-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1-(4-phenylpiperazin-1-yl)ethanone |
| InChIKey | CTDWOWIAEZCJQN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2)C(=O)CC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)