CAS 503598-17-2 appears in our catalog under these names: Imidafenacin Impurity 2, Imidafenacin Related Compound 2, Imidafenacin Impurity 5, Imidafenacin Metabolite M4, Imidafenacin Metabolite M4. Offered by: Hubei YoungXin, Chemat Brand, TargetMol, GLPBio, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1mg, 500ug.
N'-(4-amino-4-oxo-3,3-diphenylbutyl)oxamide (CAS 503598-17-2) is a chemical compound with the molecular formula C18H19N3O3 and a molecular weight of 325.4 g/mol. IUPAC name: N'-(4-amino-4-oxo-3,3-diphenylbutyl)oxamide. InChIKey: NLRIRIWDRAEJOB-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | N'-(4-amino-4-oxo-3,3-diphenylbutyl)oxamide |
| InChIKey | NLRIRIWDRAEJOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCNC(=O)C(=O)N)(C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)