CAS 34947-32-5 is the registry number for N-3-Pyridinyl-9-acridinamine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
N-pyridin-3-ylacridin-9-amine;hydrochloride (CAS 34947-32-5) is a chemical compound with the molecular formula C18H14ClN3 and a molecular weight of 307.8 g/mol. IUPAC name: N-pyridin-3-ylacridin-9-amine;hydrochloride. InChIKey: YCZYIKXLMKJRIC-UHFFFAOYSA-N.
| Molecular formula | C18H14ClN3 |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | N-pyridin-3-ylacridin-9-amine;hydrochloride |
| InChIKey | YCZYIKXLMKJRIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)NC4=CN=CC=C4.Cl |
Computed by PubChem (NCBI)