CAS 59467-86-6 appears in our catalog under these names: Midazolam Impurity 7(Midazolam EP Impurity G), 8-Chloro-1-methyl-6-phenyl-4H-imidazo(1,5-a)(1,4)benzodiazepine. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 5mg, 1mg.
8-chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine (CAS 59467-86-6) is a chemical compound with the molecular formula C18H14ClN3 and a molecular weight of 307.8 g/mol. IUPAC name: 8-chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine. InChIKey: SRJIQZQLBFVWGG-UHFFFAOYSA-N.
| Molecular formula | C18H14ClN3 |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | 8-chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine |
| InChIKey | SRJIQZQLBFVWGG-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)