Products 349549-38-8
CAS 349549-38-8 is the registry number for Glucokinase activator 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-ethyl-6-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]benzene-1,3-diol (CAS 349549-38-8) is a chemical compound with the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. IUPAC name: 4-ethyl-6-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]benzene-1,3-diol. InChIKey: JRMUPYKHGNSWEL-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O2S |
|---|---|
| Molecular weight | 287.34 g/mol |
| IUPAC name | 4-ethyl-6-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]benzene-1,3-diol |
| InChIKey | JRMUPYKHGNSWEL-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1O)O)C2=C(C=NN2)C3=CSC=N3 |
Computed by PubChem (NCBI)