CAS 349616-92-8 appears in our catalog under these names: Methyl 1-(3,4-dichlorobenzoyl)piperidine-4-carboxylate, 95%, Methyl 1-(3,4-dichlorobenzoyl)piperidine-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Methyl 1-(3,4-dichlorobenzoyl)piperidine-4-carboxylate (CAS 349616-92-8) is a chemical compound with the molecular formula C14H15Cl2NO3 and a molecular weight of 316.2 g/mol. IUPAC name: methyl 1-(3,4-dichlorobenzoyl)piperidine-4-carboxylate. InChIKey: PJYQRGXTXWSQAU-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2NO3 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | methyl 1-(3,4-dichlorobenzoyl)piperidine-4-carboxylate |
| InChIKey | PJYQRGXTXWSQAU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(CC1)C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)