Products 912763-73-6

CAS 912763-73-6 is the registry number for 1-(2,6-Dichloro-benzoylamino)cyclohexanecarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-[(2,6-dichlorobenzoyl)amino]cyclohexane-1-carboxylic acid (CAS 912763-73-6) is a chemical compound with the molecular formula C14H15Cl2NO3 and a molecular weight of 316.2 g/mol. IUPAC name: 1-[(2,6-dichlorobenzoyl)amino]cyclohexane-1-carboxylic acid. InChIKey: JRXUWCQVSGKRIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15Cl2NO3
Molecular weight316.2 g/mol
IUPAC name1-[(2,6-dichlorobenzoyl)amino]cyclohexane-1-carboxylic acid
InChIKeyJRXUWCQVSGKRIJ-UHFFFAOYSA-N
SMILESC1CCC(CC1)(C(=O)O)NC(=O)C2=C(C=CC=C2Cl)Cl

Computed by PubChem (NCBI)