CAS 34984-78-6 is the registry number for 8β–hydroxy–δ9–THC. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(6aR,8R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,8-diol (CAS 34984-78-6) is a chemical compound with the molecular formula C21H30O3 and a molecular weight of 330.5 g/mol. IUPAC name: (6aR,8R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,8-diol. InChIKey: INKUWBOHCFHXTJ-BRWVUGGUSA-N.
| Molecular formula | C21H30O3 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | (6aR,8R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,8-diol |
| InChIKey | INKUWBOHCFHXTJ-BRWVUGGUSA-N |
| SMILES | CCCCCC1=CC(=C2[C@@H]3C=C([C@@H](C[C@H]3C(OC2=C1)(C)C)O)C)O |
Computed by PubChem (NCBI)