CAS 350022-60-5 is the registry number for Methyl-5-oxo-3-p-tolyl-6,7,8,9-tetrahydro-5H-benzo [7]annulene-6-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(4-methylphenyl)-5-oxo-6,7,8,9-tetrahydrobenzo[7]annulene-6-carboxylate (CAS 350022-60-5) is a chemical compound with the molecular formula C20H20O3 and a molecular weight of 308.4 g/mol. IUPAC name: methyl 3-(4-methylphenyl)-5-oxo-6,7,8,9-tetrahydrobenzo[7]annulene-6-carboxylate. InChIKey: GJJJEVREGPXSJG-UHFFFAOYSA-N.
| Molecular formula | C20H20O3 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | methyl 3-(4-methylphenyl)-5-oxo-6,7,8,9-tetrahydrobenzo[7]annulene-6-carboxylate |
| InChIKey | GJJJEVREGPXSJG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC3=C(CCCC(C3=O)C(=O)OC)C=C2 |
Computed by PubChem (NCBI)