Products 364333-61-9
CAS 364333-61-9 is the registry number for 3-Phenyl-1-(4-((tetrahydro-2H-pyran-2-yl)oxy)phenyl)prop-2-en-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-[4-(oxan-2-yloxy)phenyl]-3-phenylprop-2-en-1-one (CAS 364333-61-9) is a chemical compound with the molecular formula C20H20O3 and a molecular weight of 308.4 g/mol. IUPAC name: (E)-1-[4-(oxan-2-yloxy)phenyl]-3-phenylprop-2-en-1-one. InChIKey: GQHOCRIJRJPRSJ-NTEUORMPSA-N.
| Molecular formula | C20H20O3 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | (E)-1-[4-(oxan-2-yloxy)phenyl]-3-phenylprop-2-en-1-one |
| InChIKey | GQHOCRIJRJPRSJ-NTEUORMPSA-N |
| SMILES | C1CCOC(C1)OC2=CC=C(C=C2)C(=O)/C=C/C3=CC=CC=C3 |
Computed by PubChem (NCBI)