CAS 35011-47-3 appears in our catalog under these names: Folic Acid EP Impurity B Sulfate, 6-Hydroxy-2,4,5-triaminopyrimidine, Sulfate, >95% (HPLC), 2,5,6-Triamino-4(3H)-pyrimidinone Sulfate, >95% (HPLC), 2,4,5–Triamino–6–hydroxypyrimidine Sulfate, 2,4,5-Triamino-6-hydroxypyrimidine sulfate, 94% . Offered by: Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: on request, 1g, 2,5g, 25g, 10g, 100g, 250g, 500g.
Sulfuric acid;2,4,5-triamino-1H-pyrimidin-6-one (CAS 35011-47-3) is a chemical compound with the molecular formula C4H9N5O5S and a molecular weight of 239.21 g/mol. IUPAC name: sulfuric acid;2,4,5-triamino-1H-pyrimidin-6-one. InChIKey: RSKNEEODWFLVFF-UHFFFAOYSA-N.
| Molecular formula | C4H9N5O5S |
|---|---|
| Molecular weight | 239.21 g/mol |
| IUPAC name | sulfuric acid;2,4,5-triamino-1H-pyrimidin-6-one |
| InChIKey | RSKNEEODWFLVFF-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(NC1=O)N)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)