CAS 35019-66-0 appears in our catalog under these names: (4S,5S)-2,2-Dimethyl-4-phenyl-1,3-dioxan-5-amine, 95%, 95%, (4S,5S)-2,2-Dimethyl-4-phenyl-1,3-dioxan-5-amine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg.
(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-amine (CAS 35019-66-0) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: (4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-amine. InChIKey: ILNGCJMEDIBPTL-QWRGUYRKSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | (4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-amine |
| InChIKey | ILNGCJMEDIBPTL-QWRGUYRKSA-N |
| SMILES | CC1(OC[C@@H]([C@@H](O1)C2=CC=CC=C2)N)C |
Computed by PubChem (NCBI)