Products 350588-43-1
CAS 350588-43-1 appears in our catalog under these names: tert-Butyl 2-bromo-4-methylbenzoate, 95%, tert-Butyl 2-bromo-4-methylbenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl 2-bromo-4-methylbenzoate (CAS 350588-43-1) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: tert-butyl 2-bromo-4-methylbenzoate. InChIKey: DAAVKWUFCAEUKS-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | tert-butyl 2-bromo-4-methylbenzoate |
| InChIKey | DAAVKWUFCAEUKS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)