CAS 350820-12-1 appears in our catalog under these names: 2,6-Dimethylnaphthalene-d12, 98 atom % D, min 98% Chemical Purity, 2,6-Dimethylnaphthalene-d12. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 1 mg, 10 mg, 5 mg.
1,2,4,5,6,8-hexadeuterio-3,7-bis(trideuteriomethyl)naphthalene (CAS 350820-12-1) is a chemical compound with the molecular formula C12H12 and a molecular weight of 168.30 g/mol. IUPAC name: 1,2,4,5,6,8-hexadeuterio-3,7-bis(trideuteriomethyl)naphthalene. InChIKey: YGYNBBAUIYTWBF-CLWNCLMISA-N.
| Molecular formula | C12H12 |
|---|---|
| Molecular weight | 168.30 g/mol |
| IUPAC name | 1,2,4,5,6,8-hexadeuterio-3,7-bis(trideuteriomethyl)naphthalene |
| InChIKey | YGYNBBAUIYTWBF-CLWNCLMISA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1C(=C(C(=C2[2H])[2H])C([2H])([2H])[2H])[2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)