CAS 51209-51-9 is the registry number for 2,6-Di(methyl-d3)-naphthalene. Offered by: TRC. Available pack sizes: 25mg.
2,6-bis(trideuteriomethyl)naphthalene (CAS 51209-51-9) is a chemical compound with the molecular formula C12H12 and a molecular weight of 162.26 g/mol. IUPAC name: 2,6-bis(trideuteriomethyl)naphthalene. InChIKey: YGYNBBAUIYTWBF-WFGJKAKNSA-N.
| Molecular formula | C12H12 |
|---|---|
| Molecular weight | 162.26 g/mol |
| IUPAC name | 2,6-bis(trideuteriomethyl)naphthalene |
| InChIKey | YGYNBBAUIYTWBF-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC2=C(C=C1)C=C(C=C2)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)