CAS 350983-37-8 is the registry number for 4-Methoxy-β,β,3-trimethylbenzenepropanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
3-(4-methoxy-3-methylphenyl)-3-methylbutanoic acid (CAS 350983-37-8) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 3-(4-methoxy-3-methylphenyl)-3-methylbutanoic acid. InChIKey: FPEDTFUDNIWOCS-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 3-(4-methoxy-3-methylphenyl)-3-methylbutanoic acid |
| InChIKey | FPEDTFUDNIWOCS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C)(C)CC(=O)O)OC |
Computed by PubChem (NCBI)