Products 350983-37-8

CAS 350983-37-8 is the registry number for 4-Methoxy-β,β,3-trimethylbenzenepropanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

3-(4-methoxy-3-methylphenyl)-3-methylbutanoic acid (CAS 350983-37-8) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 3-(4-methoxy-3-methylphenyl)-3-methylbutanoic acid. InChIKey: FPEDTFUDNIWOCS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O3
Molecular weight222.28 g/mol
IUPAC name3-(4-methoxy-3-methylphenyl)-3-methylbutanoic acid
InChIKeyFPEDTFUDNIWOCS-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)C(C)(C)CC(=O)O)OC

Computed by PubChem (NCBI)