CAS 35109-88-7 appears in our catalog under these names: 2-Iodo Adenosine35109-88-7, 2-Iodoadenosine, 98%, 2–Iodoadenosine, 2-Iodoadenosine, 2-Iodoadenosine, >98.0%(HPLC)(N). Offered by: TRC, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 100mg, 250mg, 500mg, 10g, 1g, 5g, 1000mg, 200mg.
(2R,3R,4S,5R)-2-(6-amino-2-iodopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 35109-88-7) is a chemical compound with the molecular formula C10H12IN5O4 and a molecular weight of 393.14 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-2-iodopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: MGEBVSZZNFOIRB-UUOKFMHZSA-N.
| Molecular formula | C10H12IN5O4 |
|---|---|
| Molecular weight | 393.14 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-2-iodopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | MGEBVSZZNFOIRB-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)I)N |
Computed by PubChem (NCBI)