CAS 68200-68-0 appears in our catalog under these names: 5'-Deoxy-5'-iodoguanosine, 97%, 5'–Deoxy–5'–iodoguanosine, 5'-Deoxy-5'-iodoguanosine, 5′-Deoxy-5′-iodoguanosine. Offered by: AmBeed, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 50mg, 25mg, 10mg, 100mg, Get quote.
2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-1H-purin-6-one (CAS 68200-68-0) is a chemical compound with the molecular formula C10H12IN5O4 and a molecular weight of 393.14 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: MELBRHQFQZYVJM-UUOKFMHZSA-N.
| Molecular formula | C10H12IN5O4 |
|---|---|
| Molecular weight | 393.14 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | MELBRHQFQZYVJM-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CI)O)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)