CAS 351165-23-6 is the registry number for 2-(((2-methoxy-4-nitrophenyl)amino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
3-hydroxy-2-[(2-methoxy-4-nitrophenyl)iminomethyl]inden-1-one (CAS 351165-23-6) is a chemical compound with the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. IUPAC name: 3-hydroxy-2-[(2-methoxy-4-nitrophenyl)iminomethyl]inden-1-one. InChIKey: QGYFJMQNMYPFPU-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O5 |
|---|---|
| Molecular weight | 324.29 g/mol |
| IUPAC name | 3-hydroxy-2-[(2-methoxy-4-nitrophenyl)iminomethyl]inden-1-one |
| InChIKey | QGYFJMQNMYPFPU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])N=CC2=C(C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)