CAS 3512-14-9 appears in our catalog under these names: 2,4,6-Trifluoropyridine-3-carboxylic acid, 95%, 2,4,6-Trifluoropyridine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 50mg, 0,5g.
2,4,6-trifluoropyridine-3-carboxylic acid (CAS 3512-14-9) is a chemical compound with the molecular formula C6H2F3NO2 and a molecular weight of 177.08 g/mol. IUPAC name: 2,4,6-trifluoropyridine-3-carboxylic acid. InChIKey: JRQKEZPTKZOROJ-UHFFFAOYSA-N.
| Molecular formula | C6H2F3NO2 |
|---|---|
| Molecular weight | 177.08 g/mol |
| IUPAC name | 2,4,6-trifluoropyridine-3-carboxylic acid |
| InChIKey | JRQKEZPTKZOROJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1F)F)C(=O)O)F |
Computed by PubChem (NCBI)