CAS 675602-92-3 is the registry number for 2,3,6-Trifluoroisonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,3,6-trifluoropyridine-4-carboxylic acid (CAS 675602-92-3) is a chemical compound with the molecular formula C6H2F3NO2 and a molecular weight of 177.08 g/mol. IUPAC name: 2,3,6-trifluoropyridine-4-carboxylic acid. InChIKey: RXNORRUCMWSIQZ-UHFFFAOYSA-N.
| Molecular formula | C6H2F3NO2 |
|---|---|
| Molecular weight | 177.08 g/mol |
| IUPAC name | 2,3,6-trifluoropyridine-4-carboxylic acid |
| InChIKey | RXNORRUCMWSIQZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1F)F)F)C(=O)O |
Computed by PubChem (NCBI)