Products 675602-92-3

CAS 675602-92-3 is the registry number for 2,3,6-Trifluoroisonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2,3,6-trifluoropyridine-4-carboxylic acid (CAS 675602-92-3) is a chemical compound with the molecular formula C6H2F3NO2 and a molecular weight of 177.08 g/mol. IUPAC name: 2,3,6-trifluoropyridine-4-carboxylic acid. InChIKey: RXNORRUCMWSIQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2F3NO2
Molecular weight177.08 g/mol
IUPAC name2,3,6-trifluoropyridine-4-carboxylic acid
InChIKeyRXNORRUCMWSIQZ-UHFFFAOYSA-N
SMILESC1=C(C(=C(N=C1F)F)F)C(=O)O

Computed by PubChem (NCBI)