Products 351357-29-4
CAS 351357-29-4 appears in our catalog under these names: 2-(4-Methoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid, 95%, 2-(4-Methoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid (CAS 351357-29-4) is a chemical compound with the molecular formula C19H17NO3 and a molecular weight of 307.3 g/mol. IUPAC name: 2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid. InChIKey: ZQZABHXTSVSWRN-UHFFFAOYSA-N.
| Molecular formula | C19H17NO3 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | ZQZABHXTSVSWRN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)OC)C(=O)O)C |
Computed by PubChem (NCBI)