Products 522620-92-4
CAS 522620-92-4 appears in our catalog under these names: 2-(3-Ethoxyphenyl)-8-methylquinoline-4-carboxylic acid, 95%, 2-(3-Ethoxyphenyl)-8-methylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-ethoxyphenyl)-8-methylquinoline-4-carboxylic acid (CAS 522620-92-4) is a chemical compound with the molecular formula C19H17NO3 and a molecular weight of 307.3 g/mol. IUPAC name: 2-(3-ethoxyphenyl)-8-methylquinoline-4-carboxylic acid. InChIKey: PBBWHAXIWWWXIL-UHFFFAOYSA-N.
| Molecular formula | C19H17NO3 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 2-(3-ethoxyphenyl)-8-methylquinoline-4-carboxylic acid |
| InChIKey | PBBWHAXIWWWXIL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1)C2=NC3=C(C=CC=C3C(=C2)C(=O)O)C |
Computed by PubChem (NCBI)