CAS 351498-11-8 is the registry number for N-(((3-pyridylmethyl)amino)thioxomethyl)-2-thienylformamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(pyridin-3-ylmethylcarbamothioyl)thiophene-2-carboxamide (CAS 351498-11-8) is a chemical compound with the molecular formula C12H11N3OS2 and a molecular weight of 277.4 g/mol. IUPAC name: N-(pyridin-3-ylmethylcarbamothioyl)thiophene-2-carboxamide. InChIKey: BSTJDNAVKFRNME-UHFFFAOYSA-N.
| Molecular formula | C12H11N3OS2 |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | N-(pyridin-3-ylmethylcarbamothioyl)thiophene-2-carboxamide |
| InChIKey | BSTJDNAVKFRNME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC(=S)NC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)