Products 849125-86-6
CAS 849125-86-6 is the registry number for 2-(((Thiophen-2-ylmethyl)amino)methyl)thieno[3,2-d]pyrimidin-4(3H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(thiophen-2-ylmethylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one (CAS 849125-86-6) is a chemical compound with the molecular formula C12H11N3OS2 and a molecular weight of 277.4 g/mol. IUPAC name: 2-[(thiophen-2-ylmethylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: SDIZTTTZFOLXRU-UHFFFAOYSA-N.
| Molecular formula | C12H11N3OS2 |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 2-[(thiophen-2-ylmethylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | SDIZTTTZFOLXRU-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CNCC2=NC3=C(C(=O)N2)SC=C3 |
Computed by PubChem (NCBI)