CAS 35168-64-0 appears in our catalog under these names: 3,6-Bis(bromomethyl)durene, 95%, 1,4–Bis(bromomethyl)–2,3,5,6–tetramethylbenzene, 3,6-Bis(bromomethyl)durene, >98.0%(GC)(T), 1,4-Bis(bromomethyl)-2,3,5,6-tetramethylbenzene 98%, 1,4-Bis(bromomethyl)-2,3,5,6-tetramethylbenzene, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
1,4-bis(bromomethyl)-2,3,5,6-tetramethylbenzene (CAS 35168-64-0) is a chemical compound with the molecular formula C12H16Br2 and a molecular weight of 320.06 g/mol. IUPAC name: 1,4-bis(bromomethyl)-2,3,5,6-tetramethylbenzene. InChIKey: OREPDRBSWICSCF-UHFFFAOYSA-N.
| Molecular formula | C12H16Br2 |
|---|---|
| Molecular weight | 320.06 g/mol |
| IUPAC name | 1,4-bis(bromomethyl)-2,3,5,6-tetramethylbenzene |
| InChIKey | OREPDRBSWICSCF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1CBr)C)C)CBr)C |
Computed by PubChem (NCBI)