CAS 351865-83-3 appears in our catalog under these names: (2-(3,5-Dichlorophenyl)ethynyl)trimethylsilane, 95%, (2-(3,5-Dichlorophenyl)ethynyl)trimethylsilane. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(3,5-dichlorophenyl)ethynyl-trimethylsilane (CAS 351865-83-3) is a chemical compound with the molecular formula C11H12Cl2Si and a molecular weight of 243.20 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)ethynyl-trimethylsilane. InChIKey: LUVVEBDARCWRJP-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2Si |
|---|---|
| Molecular weight | 243.20 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)ethynyl-trimethylsilane |
| InChIKey | LUVVEBDARCWRJP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)