CAS 556112-22-2 is the registry number for 2-(2,5-Dichlorophenyl)trimethylsilylacetylene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(2,5-dichlorophenyl)ethynyl-trimethylsilane (CAS 556112-22-2) is a chemical compound with the molecular formula C11H12Cl2Si and a molecular weight of 243.20 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)ethynyl-trimethylsilane. InChIKey: BCLRRMZYXXCTKF-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2Si |
|---|---|
| Molecular weight | 243.20 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)ethynyl-trimethylsilane |
| InChIKey | BCLRRMZYXXCTKF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)