Products 351898-80-1

CAS 351898-80-1 appears in our catalog under these names: 2,4-Dichloro-5-(2-methoxy-phenylsulfamoyl)-benzoic acid, 95%, 2,4-Dichloro-5-((2-methoxyphenyl)sulfamoyl)benzoic acid, 95%, 2,4-Dichloro-5-((2-methoxyphenyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-[(2-methoxyphenyl)sulfamoyl]benzoic acid (CAS 351898-80-1) is a chemical compound with the molecular formula C14H11Cl2NO5S and a molecular weight of 376.2 g/mol. IUPAC name: 2,4-dichloro-5-[(2-methoxyphenyl)sulfamoyl]benzoic acid. InChIKey: RSDVFDFGJSGSEX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11Cl2NO5S
Molecular weight376.2 g/mol
IUPAC name2,4-dichloro-5-[(2-methoxyphenyl)sulfamoyl]benzoic acid
InChIKeyRSDVFDFGJSGSEX-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1NS(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)