CAS 721415-24-3 appears in our catalog under these names: 3-((2,5-Dichlorophenyl)sulfamoyl)-4-methoxybenzoic acid, 95%, 3-(2,5-Dichloro-phenylsulfamoyl)-4-methoxy-benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
3-[(2,5-dichlorophenyl)sulfamoyl]-4-methoxybenzoic acid (CAS 721415-24-3) is a chemical compound with the molecular formula C14H11Cl2NO5S and a molecular weight of 376.2 g/mol. IUPAC name: 3-[(2,5-dichlorophenyl)sulfamoyl]-4-methoxybenzoic acid. InChIKey: NERHKLGIDJNXFW-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO5S |
|---|---|
| Molecular weight | 376.2 g/mol |
| IUPAC name | 3-[(2,5-dichlorophenyl)sulfamoyl]-4-methoxybenzoic acid |
| InChIKey | NERHKLGIDJNXFW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)NC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)