CAS 35195-77-8 appears in our catalog under these names: 3-Carbamothioylbenzoic acid, 95%, 3-Carbamothioylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-carbamothioylbenzoic acid (CAS 35195-77-8) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: 3-carbamothioylbenzoic acid. InChIKey: YNHKKSMYDIEQKY-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 3-carbamothioylbenzoic acid |
| InChIKey | YNHKKSMYDIEQKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(=S)N |
Computed by PubChem (NCBI)