Products 352023-37-1

CAS 352023-37-1 is the registry number for 2-(1-Azepanylcarbonyl)cyclohexanecarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(azepane-1-carbonyl)cyclohexane-1-carboxylic acid (CAS 352023-37-1) is a chemical compound with the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. IUPAC name: 2-(azepane-1-carbonyl)cyclohexane-1-carboxylic acid. InChIKey: KYLPETYBULKPEF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23NO3
Molecular weight253.34 g/mol
IUPAC name2-(azepane-1-carbonyl)cyclohexane-1-carboxylic acid
InChIKeyKYLPETYBULKPEF-UHFFFAOYSA-N
SMILESC1CCCN(CC1)C(=O)C2CCCCC2C(=O)O

Computed by PubChem (NCBI)