CAS 35212-99-8 appears in our catalog under these names: Methyl 5,6-Dimethoxybenzothiophene-2-carboxylate, 98%, 98%, Methyl 5,6-Dimethoxybenzothiophene-2-carboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g.
Methyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate (CAS 35212-99-8) is a chemical compound with the molecular formula C12H12O4S and a molecular weight of 252.29 g/mol. IUPAC name: methyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate. InChIKey: GUZPWUYCMLYIPS-UHFFFAOYSA-N.
| Molecular formula | C12H12O4S |
|---|---|
| Molecular weight | 252.29 g/mol |
| IUPAC name | methyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate |
| InChIKey | GUZPWUYCMLYIPS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(S2)C(=O)OC)OC |
Computed by PubChem (NCBI)