Products 352278-81-0
CAS 352278-81-0 appears in our catalog under these names: Methyl 4-chloro-2,6-dimethylbenzoate, 95%, Methyl 4-chloro-2,6-dimethylbenzoate, ≥95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Methyl 4-chloro-2,6-dimethylbenzoate (CAS 352278-81-0) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: methyl 4-chloro-2,6-dimethylbenzoate. InChIKey: AYZBBWJXRTYFHI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | methyl 4-chloro-2,6-dimethylbenzoate |
| InChIKey | AYZBBWJXRTYFHI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)OC)C)Cl |
Computed by PubChem (NCBI)