CAS 3528-49-2 appears in our catalog under these names: 2-Benzyl-4-methyl-2 H -pyrazol-3-ylamine, 95%, 1-Benzyl-4-methyl-1h-pyrazol-5-amine, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.
1-benzyl-4-methylpyrazol-5-amine (CAS 3528-49-2) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 1-benzyl-4-methylpyrazol-5-amine. InChIKey: SVINJSJPUAJVMO-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 1-benzyl-4-methylpyrazol-5-amine |
| InChIKey | SVINJSJPUAJVMO-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)