CAS 3528-51-6 appears in our catalog under these names: 1-Benzyl-1H-pyrazol-5-amine, 97%, 1-Benzyl-1H-pyrazol-5-amine 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-benzylpyrazol-3-amine (CAS 3528-51-6) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: 2-benzylpyrazol-3-amine. InChIKey: CJDYNUBRSBSSJU-UHFFFAOYSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2-benzylpyrazol-3-amine |
| InChIKey | CJDYNUBRSBSSJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=CC=N2)N |
Computed by PubChem (NCBI)