CAS 35285-69-9 appears in our catalog under these names: Propylparaben Sodium Salt, 4-Hydroxybenzoic acid-propyl ester sodium, Sodium Propyl Parahydroxybenzoate, Sodium Propylparaben, >95% (HPLC), Propylparaben sodium. Offered by: Chemat Brand, Dr. Ehrenstorfer, Mikromol, LoGiCal, TRC. Available pack sizes: on request, 250mg, 100mg, 10mg, 1g, 25g, 5g, 5mg.
Sodium 4-propoxycarbonylphenolate (CAS 35285-69-9) is a chemical compound with the molecular formula C10H11NaO3 and a molecular weight of 202.18 g/mol. IUPAC name: sodium 4-propoxycarbonylphenolate. InChIKey: IXMINYBUNCWGER-UHFFFAOYSA-M.
| Molecular formula | C10H11NaO3 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | sodium 4-propoxycarbonylphenolate |
| InChIKey | IXMINYBUNCWGER-UHFFFAOYSA-M |
| SMILES | CCCOC(=O)C1=CC=C(C=C1)[O-].[Na+] |
Computed by PubChem (NCBI)