CAS 40951-19-7 appears in our catalog under these names: β–phenyl GHB (sodium salt), β-Phenyl GHB sodium 95%, Sodium 4-hydroxy-3-phenylbutanoate, 95%, 95%, β-Phenyl GHB (sodium), 98.77%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 1g, 5g, 25g, 100g, 1 g, 5 g.
Sodium 4-hydroxy-3-phenylbutanoate (CAS 40951-19-7) is a chemical compound with the molecular formula C10H11NaO3 and a molecular weight of 202.18 g/mol. IUPAC name: sodium 4-hydroxy-3-phenylbutanoate. InChIKey: IYRHDHMHGKWQGK-UHFFFAOYSA-M.
| Molecular formula | C10H11NaO3 |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | sodium 4-hydroxy-3-phenylbutanoate |
| InChIKey | IYRHDHMHGKWQGK-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(CC(=O)[O-])CO.[Na+] |
Computed by PubChem (NCBI)