CAS 353258-15-8 appears in our catalog under these names: 6,8-Dichloro-2-(2-methoxyphenyl)imidazo[1,2-a]pyridine, 95%, 6,8-Dichloro-2-(2-methoxyphenyl)imidazo[1,2-a]pyridine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
6,8-dichloro-2-(2-methoxyphenyl)imidazo[1,2-a]pyridine (CAS 353258-15-8) is a chemical compound with the molecular formula C14H10Cl2N2O and a molecular weight of 293.1 g/mol. IUPAC name: 6,8-dichloro-2-(2-methoxyphenyl)imidazo[1,2-a]pyridine. InChIKey: JZGQRSGECKNPSD-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2N2O |
|---|---|
| Molecular weight | 293.1 g/mol |
| IUPAC name | 6,8-dichloro-2-(2-methoxyphenyl)imidazo[1,2-a]pyridine |
| InChIKey | JZGQRSGECKNPSD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CN3C=C(C=C(C3=N2)Cl)Cl |
Computed by PubChem (NCBI)