CAS 632300-37-9 is the registry number for 2-[(3,4-Dichlorophenoxy)methyl]-1h-benzimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(3,4-dichlorophenoxy)methyl]-1H-benzimidazole (CAS 632300-37-9) is a chemical compound with the molecular formula C14H10Cl2N2O and a molecular weight of 293.1 g/mol. IUPAC name: 2-[(3,4-dichlorophenoxy)methyl]-1H-benzimidazole. InChIKey: PPGJHDJVHHEMBE-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2N2O |
|---|---|
| Molecular weight | 293.1 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenoxy)methyl]-1H-benzimidazole |
| InChIKey | PPGJHDJVHHEMBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)COC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)