Products 353265-77-7
CAS 353265-77-7 appears in our catalog under these names: 3-(2-Oxo-1,3-oxazolidin-3-yl)benzonitrile, 95%, 3-(2-Oxo-1,3-oxazolidin-3-yl)benzonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 2,5g.
3-(2-oxo-1,3-oxazolidin-3-yl)benzonitrile (CAS 353265-77-7) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 3-(2-oxo-1,3-oxazolidin-3-yl)benzonitrile. InChIKey: OXIRRKMUBOFATG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 3-(2-oxo-1,3-oxazolidin-3-yl)benzonitrile |
| InChIKey | OXIRRKMUBOFATG-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)