CAS 35408-03-8 is the registry number for (+)-Apoverbenone. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5R)-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one (CAS 35408-03-8) is a chemical compound with the molecular formula C9H12O and a molecular weight of 136.19 g/mol. IUPAC name: (1R,5R)-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one. InChIKey: NNPXUZFTLBPVNP-BQBZGAKWSA-N.
| Molecular formula | C9H12O |
|---|---|
| Molecular weight | 136.19 g/mol |
| IUPAC name | (1R,5R)-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one |
| InChIKey | NNPXUZFTLBPVNP-BQBZGAKWSA-N |
| SMILES | CC1([C@@H]2C[C@H]1C(=O)C=C2)C |
Computed by PubChem (NCBI)