CAS 52691-72-2 is the registry number for (-)-Apoverbenone . Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5S)-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one (CAS 52691-72-2) is a chemical compound with the molecular formula C9H12O and a molecular weight of 136.19 g/mol. IUPAC name: (1S,5S)-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one. InChIKey: NNPXUZFTLBPVNP-RNFRBKRXSA-N.
| Molecular formula | C9H12O |
|---|---|
| Molecular weight | 136.19 g/mol |
| IUPAC name | (1S,5S)-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one |
| InChIKey | NNPXUZFTLBPVNP-RNFRBKRXSA-N |
| SMILES | CC1([C@H]2C[C@@H]1C(=O)C=C2)C |
Computed by PubChem (NCBI)