CAS 355-41-9 is the registry number for Perfluorohexyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (CAS 355-41-9) is a chemical compound with the molecular formula C6ClF13 and a molecular weight of 354.49 g/mol. IUPAC name: 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane. InChIKey: BDUCYIFEYLMINO-UHFFFAOYSA-N.
| Molecular formula | C6ClF13 |
|---|---|
| Molecular weight | 354.49 g/mol |
| IUPAC name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane |
| InChIKey | BDUCYIFEYLMINO-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)Cl)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)