CAS 67437-97-2 is the registry number for 2-Chloro-2-(trifluoromethyl)perfluoropentane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.
2-chloro-1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentane (CAS 67437-97-2) is a chemical compound with the molecular formula C6ClF13 and a molecular weight of 354.49 g/mol. IUPAC name: 2-chloro-1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentane. InChIKey: NTLNMNNHUJOUOM-UHFFFAOYSA-N.
| Molecular formula | C6ClF13 |
|---|---|
| Molecular weight | 354.49 g/mol |
| IUPAC name | 2-chloro-1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentane |
| InChIKey | NTLNMNNHUJOUOM-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)Cl |
Computed by PubChem (NCBI)