CAS 355-63-5 is the registry number for Perfluoroheptene-1, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluorohept-1-ene (CAS 355-63-5) is a chemical compound with the molecular formula C7F14 and a molecular weight of 350.05 g/mol. IUPAC name: 1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluorohept-1-ene. InChIKey: CDAVUOSPHHTNBU-UHFFFAOYSA-N.
| Molecular formula | C7F14 |
|---|---|
| Molecular weight | 350.05 g/mol |
| IUPAC name | 1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluorohept-1-ene |
| InChIKey | CDAVUOSPHHTNBU-UHFFFAOYSA-N |
| SMILES | C(=C(F)F)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)