CAS 71039-88-8 is the registry number for Perfluorohept-3-ene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-1,1,1,2,2,3,4,5,5,6,6,7,7,7-tetradecafluorohept-3-ene (CAS 71039-88-8) is a chemical compound with the molecular formula C7F14 and a molecular weight of 350.05 g/mol. IUPAC name: (E)-1,1,1,2,2,3,4,5,5,6,6,7,7,7-tetradecafluorohept-3-ene. InChIKey: UAEWLONMSWUOCA-OWOJBTEDSA-N.
| Molecular formula | C7F14 |
|---|---|
| Molecular weight | 350.05 g/mol |
| IUPAC name | (E)-1,1,1,2,2,3,4,5,5,6,6,7,7,7-tetradecafluorohept-3-ene |
| InChIKey | UAEWLONMSWUOCA-OWOJBTEDSA-N |
| SMILES | C(=C(/C(C(F)(F)F)(F)F)\F)(\C(C(C(F)(F)F)(F)F)(F)F)/F |
Computed by PubChem (NCBI)