CAS 35547-25-2 is the registry number for 5-(2-Methyl-3,5-dinitrophenyl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-methyl-3,5-dinitrophenyl)-1,3,4-thiadiazol-2-amine (CAS 35547-25-2) is a chemical compound with the molecular formula C9H7N5O4S and a molecular weight of 281.25 g/mol. IUPAC name: 5-(2-methyl-3,5-dinitrophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: BESPHMBYXAKQEK-UHFFFAOYSA-N.
| Molecular formula | C9H7N5O4S |
|---|---|
| Molecular weight | 281.25 g/mol |
| IUPAC name | 5-(2-methyl-3,5-dinitrophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | BESPHMBYXAKQEK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C2=NN=C(S2)N |
Computed by PubChem (NCBI)