Products 393126-60-8

CAS 393126-60-8 is the registry number for 2-(1-Methyl-1h-tetrazol-5-ylsulfanyl)-5-nitro-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoic acid (CAS 393126-60-8) is a chemical compound with the molecular formula C9H7N5O4S and a molecular weight of 281.25 g/mol. IUPAC name: 2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoic acid. InChIKey: VZOHBELMYVQRQG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7N5O4S
Molecular weight281.25 g/mol
IUPAC name2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoic acid
InChIKeyVZOHBELMYVQRQG-UHFFFAOYSA-N
SMILESCN1C(=NN=N1)SC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)