CAS 35554-48-4 is the registry number for (1Z,2E)-3-Phenyl-n-(4h-1,2,4-triazol-4-yl)prop-2-en-1-imine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine (CAS 35554-48-4) is a chemical compound with the molecular formula C11H10N4 and a molecular weight of 198.22 g/mol. IUPAC name: (Z,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine. InChIKey: HIQAKCUTUJDMGW-UQAUATQKSA-N.
| Molecular formula | C11H10N4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (Z,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine |
| InChIKey | HIQAKCUTUJDMGW-UQAUATQKSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=N\N2C=NN=C2 |
Computed by PubChem (NCBI)